C25H32O4Se — CID 177404405
(Z)-1,3-diethoxy-3-oxo-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylprop-1-en-1-olate (PubChem CID 177404405) has the molecular formula C25H32O4Se and a molecular weight of 475.49 g/mol. Its IUPAC name is (Z)-1,3-diethoxy-3-oxo-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylprop-1-en-1-olate.
| Compound Name | (Z)-1,3-diethoxy-3-oxo-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylprop-1-en-1-olate |
|---|---|
| PubChem CID | 177404405 |
| Molecular Formula | C25H32O4Se |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (Z)-1,3-diethoxy-3-oxo-2-(1',7',7'-trimethylspiro[1,3-dihydroindene-2,3'-bicyclo[2.2.1]heptane]-2'-ylidene)selaniumylprop-1-en-1-olate |
| SMILES | CCOC(=O)C(/[Se+]=C1/C2(Cc3ccccc3C2)C2CCC1(C)C2(C)C)=C(\[O-])OCC |
| InChI | InChI=1S/C25H32O4Se/c1-6-28-20(26)19(21(27)29-7-2)30-22-24(5)13-12-18(23(24,3)4)25(22)14-16-10-8-9-11-17(16)15-25/h8-11,18H,6-7,12-15H2,1-5H3 |
| InChIKey | OUNJEXSMLFUVAG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|