C18H14O3 — CID 177404495
(2E,3aS,8bR)-2-[hydroxy(phenyl)methylidene]-3a,8b-dihydro-1H-cyclopenta[b][1]benzofuran-3-one (PubChem CID 177404495) has the molecular formula C18H14O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2E,3aS,8bR)-2-[hydroxy(phenyl)methylidene]-3a,8b-dihydro-1H-cyclopenta[b][1]benzofuran-3-one.
| Compound Name | (2E,3aS,8bR)-2-[hydroxy(phenyl)methylidene]-3a,8b-dihydro-1H-cyclopenta[b][1]benzofuran-3-one |
|---|---|
| PubChem CID | 177404495 |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | (2E,3aS,8bR)-2-[hydroxy(phenyl)methylidene]-3a,8b-dihydro-1H-cyclopenta[b][1]benzofuran-3-one |
| SMILES | O=C1/C(=C(/O)c2ccccc2)C[C@@H]2c3ccccc3O[C@H]12 |
| InChI | InChI=1S/C18H14O3/c19-16(11-6-2-1-3-7-11)14-10-13-12-8-4-5-9-15(12)21-18(13)17(14)20/h1-9,13,18-19H,10H2/b16-14+/t13-,18+/m1/s1 |
| InChIKey | TZDJWYSTEUUJJQ-QOPIQBEESA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|