C20H16ClN5O — CID 177404599
7-chloro-N-[(E)-furan-2-ylmethylideneamino]-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-amine (PubChem CID 177404599) has the molecular formula C20H16ClN5O and a molecular weight of 377.84 g/mol. Its IUPAC name is 7-chloro-N-[(E)-furan-2-ylmethylideneamino]-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-amine.
| Compound Name | 7-chloro-N-[(E)-furan-2-ylmethylideneamino]-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-amine |
|---|---|
| PubChem CID | 177404599 |
| Molecular Formula | C20H16ClN5O |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 7-chloro-N-[(E)-furan-2-ylmethylideneamino]-3-methyl-5-phenyl-1,3,4-benzotriazepin-2-amine |
| SMILES | CN1N=C(c2ccccc2)c2cc(Cl)ccc2N=C1N/N=C/c1ccco1 |
| InChI | InChI=1S/C20H16ClN5O/c1-26-20(24-22-13-16-8-5-11-27-16)23-18-10-9-15(21)12-17(18)19(25-26)14-6-3-2-4-7-14/h2-13H,1H3,(H,23,24)/b22-13+ |
| InChIKey | YUOAVVIGNYHZDV-LPYMAVHISA-N |
| XLogP | 4.24 |
| TPSA | 65.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|