C22H29N3O5 — CID 177404862
2-[(Z)-[(2R)-1-[(4R)-5,5-dimethyl-2-oxo-1,3-oxazinan-4-yl]-2-methoxyheptylidene]amino]isoindole-1,3-dione (PubChem CID 177404862) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[(Z)-[(2R)-1-[(4R)-5,5-dimethyl-2-oxo-1,3-oxazinan-4-yl]-2-methoxyheptylidene]amino]isoindole-1,3-dione.
| Compound Name | 2-[(Z)-[(2R)-1-[(4R)-5,5-dimethyl-2-oxo-1,3-oxazinan-4-yl]-2-methoxyheptylidene]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 177404862 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-[(Z)-[(2R)-1-[(4R)-5,5-dimethyl-2-oxo-1,3-oxazinan-4-yl]-2-methoxyheptylidene]amino]isoindole-1,3-dione |
| SMILES | CCCCC[C@@H](OC)/C(=N\N1C(=O)c2ccccc2C1=O)[C@@H]1NC(=O)OCC1(C)C |
| InChI | InChI=1S/C22H29N3O5/c1-5-6-7-12-16(29-4)17(18-22(2,3)13-30-21(28)23-18)24-25-19(26)14-10-8-9-11-15(14)20(25)27/h8-11,16,18H,5-7,12-13H2,1-4H3,(H,23,28)/b24-17+/t16-,18+/m1/s1 |
| InChIKey | PGXSAGVLOJYHPM-OBXARFBJSA-N |
| XLogP | 3.37 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|