C27H42O6 — CID 177404911
5-[(Z)-6-[5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]hex-2-enyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane-4,6-dione (PubChem CID 177404911) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 5-[(Z)-6-[5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]hex-2-enyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(Z)-6-[5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]hex-2-enyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 177404911 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 5-[(Z)-6-[5-[(E)-hex-2-enyl]-2,2-dimethyl-1,3-dioxan-5-yl]hex-2-enyl]-2,2-dimethyl-5-prop-2-enyl-1,3-dioxane-4,6-dione |
| SMILES | C=CCC1(C/C=C\CCCC2(C/C=C/CCC)COC(C)(C)OC2)C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C27H42O6/c1-7-9-10-13-17-26(20-30-24(3,4)31-21-26)18-14-11-12-15-19-27(16-8-2)22(28)32-25(5,6)33-23(27)29/h8,10,12-13,15H,2,7,9,11,14,16-21H2,1,3-6H3/b13-10+,15-12- |
| InChIKey | VPGZPSULIFQAKI-SCBZVQIHSA-N |
| XLogP | 6.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|