C20H32O3 — CID 177405334
(1R,4R,9S,10R,13R,15R)-15-hydroxy-15-(hydroxymethyl)-5,5-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-9-carbaldehyde (PubChem CID 177405334) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (1R,4R,9S,10R,13R,15R)-15-hydroxy-15-(hydroxymethyl)-5,5-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-9-carbaldehyde.
| Compound Name | (1R,4R,9S,10R,13R,15R)-15-hydroxy-15-(hydroxymethyl)-5,5-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-9-carbaldehyde |
|---|---|
| PubChem CID | 177405334 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (1R,4R,9S,10R,13R,15R)-15-hydroxy-15-(hydroxymethyl)-5,5-dimethyltetracyclo[11.2.1.01,10.04,9]hexadecane-9-carbaldehyde |
| SMILES | CC1(C)CCC[C@]2(C=O)[C@@H]1CC[C@@]13C[C@@H](CC[C@@H]21)C[C@]3(O)CO |
| InChI | InChI=1S/C20H32O3/c1-17(2)7-3-8-18(12-21)15(17)6-9-19-10-14(4-5-16(18)19)11-20(19,23)13-22/h12,14-16,22-23H,3-11,13H2,1-2H3/t14-,15-,16+,18+,19-,20+/m1/s1 |
| InChIKey | SLTCYPUYBSBNPJ-OWJTWYAJSA-N |
| XLogP | 3.32 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|