C31H52O3SSi2 — CID 177405478
(2Z,4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2-[(4-methylphenyl)sulfanylmethylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one (PubChem CID 177405478) has the molecular formula C31H52O3SSi2 and a molecular weight of 560.99 g/mol. Its IUPAC name is (2Z,4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2-[(4-methylphenyl)sulfanylmethylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one.
| Compound Name | (2Z,4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2-[(4-methylphenyl)sulfanylmethylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
|---|---|
| PubChem CID | 177405478 |
| Molecular Formula | C31H52O3SSi2 |
| Molecular Weight | 560.99 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (2Z,4S,4aR,6S,8aS)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-8a-methyl-2-[(4-methylphenyl)sulfanylmethylidene]-4,4a,5,6,7,8-hexahydro-3H-naphthalen-1-one |
| SMILES | Cc1ccc(S/C=C2/C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]3(C)C2=O)cc1 |
| InChI | InChI=1S/C31H52O3SSi2/c1-22-13-15-25(16-14-22)35-21-23-19-27(34-37(11,12)30(5,6)7)26-20-24(17-18-31(26,8)28(23)32)33-36(9,10)29(2,3)4/h13-16,21,24,26-27H,17-20H2,1-12H3/b23-21-/t24-,26-,27-,31-/m0/s1 |
| InChIKey | QTMISMPBODLNBB-KISLNFPFSA-N |
| XLogP | 9.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.99 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|