C14H13FN2 — CID 177405895
7-fluoro-4-propan-2-ylpyrrolo[1,2-a]quinoxaline (PubChem CID 177405895) has the molecular formula C14H13FN2 and a molecular weight of 228.27 g/mol. Its IUPAC name is 7-fluoro-4-propan-2-ylpyrrolo[1,2-a]quinoxaline.
| Compound Name | 7-fluoro-4-propan-2-ylpyrrolo[1,2-a]quinoxaline |
|---|---|
| PubChem CID | 177405895 |
| Molecular Formula | C14H13FN2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 7-fluoro-4-propan-2-ylpyrrolo[1,2-a]quinoxaline |
| SMILES | CC(C)c1nc2cc(F)ccc2n2cccc12 |
| InChI | InChI=1S/C14H13FN2/c1-9(2)14-13-4-3-7-17(13)12-6-5-10(15)8-11(12)16-14/h3-9H,1-2H3 |
| InChIKey | NUBFSJXPQLRLOD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |