About butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium
butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium (PubChem CID 177406024) has the molecular formula C14H24O2P+
and a molecular weight of 255.32 g/mol. Its IUPAC name is butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium.
Molecular Properties
| Compound Name | butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium |
| PubChem CID | 177406024 |
| Molecular Formula | C14H24O2P+ |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium |
| SMILES | CCCCO[P+](=O)CC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C14H24O2P/c1-4-5-8-16-17(15)10-11-6-7-12-9-13(11)14(12,2)3/h6,12-13H,4-5,7-10H2,1-3H3/q+1 |
| InChIKey | QCPMFCMBCOBEMK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium?
The IUPAC name of butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium (CID 177406024) is butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium.
What is the SMILES notation for butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium?
The canonical SMILES for butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium is CCCCO[P+](=O)CC1=CCC2CC1C2(C)C.
What is the InChIKey of butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium?
The InChIKey is QCPMFCMBCOBEMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2P/c1-4-5-8-16-17(15)10-11-6-7-12-9-13(11)14(12,2)3/h6,12-13H,4-5,7-10H2,1-3H3/q+1.
What are the key properties of butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium?
butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium has a molecular weight of 255.32 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butoxy-[(6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl)methyl]-oxophosphanium is sourced from PubChem (CID 177406024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).