C22H27BrF3NO6SSi — CID 177406098
ethyl 2-(4-bromoanilino)-3-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]propanoate (PubChem CID 177406098) has the molecular formula C22H27BrF3NO6SSi and a molecular weight of 598.51 g/mol. Its IUPAC name is ethyl 2-(4-bromoanilino)-3-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]propanoate.
| Compound Name | ethyl 2-(4-bromoanilino)-3-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]propanoate |
|---|---|
| PubChem CID | 177406098 |
| Molecular Formula | C22H27BrF3NO6SSi |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | ethyl 2-(4-bromoanilino)-3-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1cc(OC)c([Si](C)(C)C)c(OS(=O)(=O)C(F)(F)F)c1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H27BrF3NO6SSi/c1-6-32-21(28)17(27-16-9-7-15(23)8-10-16)11-14-12-18(31-2)20(35(3,4)5)19(13-14)33-34(29,30)22(24,25)26/h7-10,12-13,17,27H,6,11H2,1-5H3 |
| InChIKey | RYCTXJIHYFRSBO-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|