C13H18O2 — CID 177407435
(4Z)-4-(methoxymethylidene)-2-[(E)-prop-1-enyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran (PubChem CID 177407435) has the molecular formula C13H18O2 and a molecular weight of 206.29 g/mol. Its IUPAC name is (4Z)-4-(methoxymethylidene)-2-[(E)-prop-1-enyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran.
| Compound Name | (4Z)-4-(methoxymethylidene)-2-[(E)-prop-1-enyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran |
|---|---|
| PubChem CID | 177407435 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (4Z)-4-(methoxymethylidene)-2-[(E)-prop-1-enyl]-3,5,6,7-tetrahydro-2H-cyclopenta[b]pyran |
| SMILES | C/C=C/C1C/C(=C/OC)C2=C(CCC2)O1 |
| InChI | InChI=1S/C13H18O2/c1-3-5-11-8-10(9-14-2)12-6-4-7-13(12)15-11/h3,5,9,11H,4,6-8H2,1-2H3/b5-3+,10-9- |
| InChIKey | CUDLYLJVRWFNML-ZFDIDYEQSA-N |
| XLogP | 3.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|