About ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate
ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate (PubChem CID 177407491) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate |
| PubChem CID | 177407491 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1/CCC[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C10H14O3/c1-2-12-9(11)6-7-4-3-5-8-10(7)13-8/h6,8,10H,2-5H2,1H3/b7-6-/t8-,10+/m1/s1 |
| InChIKey | KEEVMLRYARKQSG-KMKZCQIISA-N |
| XLogP | 1.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate (CID 177407491) is ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate is CCOC(=O)/C=C1/CCC[C@H]2O[C@@H]12.
What is the InChIKey of ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate?
The InChIKey is KEEVMLRYARKQSG-KMKZCQIISA-N. The full InChI is InChI=1S/C10H14O3/c1-2-12-9(11)6-7-4-3-5-8-10(7)13-8/h6,8,10H,2-5H2,1H3/b7-6-/t8-,10+/m1/s1.
What are the key properties of ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate?
ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate has a molecular weight of 182.22 g/mol, XLogP of 1.43, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[(1S,6R)-7-oxabicyclo[4.1.0]heptan-2-ylidene]acetate is sourced from PubChem (CID 177407491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).