About zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane
zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane (PubChem CID 177408648) has the molecular formula C12H24N2Zn
and a molecular weight of 261.73 g/mol. Its IUPAC name is zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane.
Molecular Properties
| Compound Name | zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane |
| PubChem CID | 177408648 |
| Molecular Formula | C12H24N2Zn |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane |
| SMILES | CN(C)[N-]C1=CCCCC1.C[C-](C)C.[Zn+2] |
| InChI | InChI=1S/C8H15N2.C4H9.Zn/c1-10(2)9-8-6-4-3-5-7-8;1-4(2)3;/h6H,3-5,7H2,1-2H3;1-3H3;/q2*-1;+2 |
| InChIKey | WOLHAXYUEURGRR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane?
The IUPAC name of zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane (CID 177408648) is zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane.
What is the SMILES notation for zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane?
The canonical SMILES for zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane is CN(C)[N-]C1=CCCCC1.C[C-](C)C.[Zn+2].
What is the InChIKey of zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane?
The InChIKey is WOLHAXYUEURGRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N2.C4H9.Zn/c1-10(2)9-8-6-4-3-5-7-8;1-4(2)3;/h6H,3-5,7H2,1-2H3;1-3H3;/q2*-1;+2.
What are the key properties of zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane?
zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane has a molecular weight of 261.73 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;cyclohexen-1-yl(dimethylamino)azanide;2-methylpropane is sourced from PubChem (CID 177408648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).