C10H10O5 — CID 177409278
(1S,2S,6R,7R)-8,9-dihydroxy-10-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 177409278) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is (1S,2S,6R,7R)-8,9-dihydroxy-10-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2S,6R,7R)-8,9-dihydroxy-10-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 177409278 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (1S,2S,6R,7R)-8,9-dihydroxy-10-methyl-4-oxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1[C@H]2C(O)=C(O)[C@@H]1[C@@H]1C(=O)OC(=O)[C@@H]12 |
| InChI | InChI=1S/C10H10O5/c1-2-3-5-6(10(14)15-9(5)13)4(2)8(12)7(3)11/h2-6,11-12H,1H3/t2?,3-,4+,5-,6+ |
| InChIKey | CHDLUDQQVMUPKZ-ZMIWAGRTSA-N |
| XLogP | 0.53 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|