C16H22O6 — CID 177409496
(2R,6S,10S,13R)-4,4,11,11-tetramethyl-3,5,12,16-tetraoxatetracyclo[8.6.0.01,13.02,6]hexadecane-7,15-dione (PubChem CID 177409496) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is (2R,6S,10S,13R)-4,4,11,11-tetramethyl-3,5,12,16-tetraoxatetracyclo[8.6.0.01,13.02,6]hexadecane-7,15-dione.
| Compound Name | (2R,6S,10S,13R)-4,4,11,11-tetramethyl-3,5,12,16-tetraoxatetracyclo[8.6.0.01,13.02,6]hexadecane-7,15-dione |
|---|---|
| PubChem CID | 177409496 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (2R,6S,10S,13R)-4,4,11,11-tetramethyl-3,5,12,16-tetraoxatetracyclo[8.6.0.01,13.02,6]hexadecane-7,15-dione |
| SMILES | CC1(C)OC2[C@H](O1)C(=O)CC[C@H]1C(C)(C)O[C@@H]3CC(=O)OC231 |
| InChI | InChI=1S/C16H22O6/c1-14(2)9-6-5-8(17)12-13(22-15(3,4)21-12)16(9)10(19-14)7-11(18)20-16/h9-10,12-13H,5-7H2,1-4H3/t9-,10+,12+,13?,16?/m0/s1 |
| InChIKey | SLJOEGUPUDXVMJ-VGMRCNJRSA-N |
| XLogP | 1.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |