C16H21NO7 — CID 177409622
3-[(4R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]propyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate (PubChem CID 177409622) has the molecular formula C16H21NO7 and a molecular weight of 339.34 g/mol. Its IUPAC name is 3-[(4R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]propyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate.
| Compound Name | 3-[(4R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]propyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 177409622 |
| Molecular Formula | C16H21NO7 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 3-[(4R,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydro-4,7-epoxyisoindol-2-yl]propyl 3-hydroxy-2-(hydroxymethyl)-2-methylpropanoate |
| SMILES | CC(CO)(CO)C(=O)OCCCN1C(=O)C2[C@@H](C1=O)C1C=C[C@H]2O1 |
| InChI | InChI=1S/C16H21NO7/c1-16(7-18,8-19)15(22)23-6-2-5-17-13(20)11-9-3-4-10(24-9)12(11)14(17)21/h3-4,9-12,18-19H,2,5-8H2,1H3/t9-,10?,11?,12+/m1/s1 |
| InChIKey | NXLMEQQNGNFLRJ-YYJSSNLHSA-N |
| XLogP | -1.15 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|