C32H30N4O2 — CID 177409674
1-[(2S)-2-methoxypropyl]-2-[2-[10-[2-[1-[(2S)-2-methoxypropyl]imidazol-2-yl]ethynyl]anthracen-9-yl]ethynyl]imidazole (PubChem CID 177409674) has the molecular formula C32H30N4O2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 1-[(2S)-2-methoxypropyl]-2-[2-[10-[2-[1-[(2S)-2-methoxypropyl]imidazol-2-yl]ethynyl]anthracen-9-yl]ethynyl]imidazole.
| Compound Name | 1-[(2S)-2-methoxypropyl]-2-[2-[10-[2-[1-[(2S)-2-methoxypropyl]imidazol-2-yl]ethynyl]anthracen-9-yl]ethynyl]imidazole |
|---|---|
| PubChem CID | 177409674 |
| Molecular Formula | C32H30N4O2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | 1-[(2S)-2-methoxypropyl]-2-[2-[10-[2-[1-[(2S)-2-methoxypropyl]imidazol-2-yl]ethynyl]anthracen-9-yl]ethynyl]imidazole |
| SMILES | CO[C@@H](C)Cn1ccnc1C#Cc1c2ccccc2c(C#Cc2nccn2C[C@H](C)OC)c2ccccc12 |
| InChI | InChI=1S/C32H30N4O2/c1-23(37-3)21-35-19-17-33-31(35)15-13-29-25-9-5-7-11-27(25)30(28-12-8-6-10-26(28)29)14-16-32-34-18-20-36(32)22-24(2)38-4/h5-12,17-20,23-24H,21-22H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | ZOQNPFLBNSYWID-ZEQRLZLVSA-N |
| XLogP | 5.26 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|