About (5E)-5-propylidene-1,3-oxazolidin-2-one
(5E)-5-propylidene-1,3-oxazolidin-2-one (PubChem CID 177409820) has the molecular formula C6H9NO2
and a molecular weight of 127.14 g/mol. Its IUPAC name is (5E)-5-propylidene-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (5E)-5-propylidene-1,3-oxazolidin-2-one |
| PubChem CID | 177409820 |
| Molecular Formula | C6H9NO2 |
| Molecular Weight | 127.14 g/mol |
| Exact Mass | 127.06 |
| IUPAC Name | (5E)-5-propylidene-1,3-oxazolidin-2-one |
| SMILES | CC/C=C1\CNC(=O)O1 |
| InChI | InChI=1S/C6H9NO2/c1-2-3-5-4-7-6(8)9-5/h3H,2,4H2,1H3,(H,7,8)/b5-3+ |
| InChIKey | UDTOVVZRVYLPTO-HWKANZROSA-N |
| XLogP | 1.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-propylidene-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-propylidene-1,3-oxazolidin-2-one?
The IUPAC name of (5E)-5-propylidene-1,3-oxazolidin-2-one (CID 177409820) is (5E)-5-propylidene-1,3-oxazolidin-2-one.
What is the SMILES notation for (5E)-5-propylidene-1,3-oxazolidin-2-one?
The canonical SMILES for (5E)-5-propylidene-1,3-oxazolidin-2-one is CC/C=C1\CNC(=O)O1.
What is the InChIKey of (5E)-5-propylidene-1,3-oxazolidin-2-one?
The InChIKey is UDTOVVZRVYLPTO-HWKANZROSA-N. The full InChI is InChI=1S/C6H9NO2/c1-2-3-5-4-7-6(8)9-5/h3H,2,4H2,1H3,(H,7,8)/b5-3+.
What are the key properties of (5E)-5-propylidene-1,3-oxazolidin-2-one?
(5E)-5-propylidene-1,3-oxazolidin-2-one has a molecular weight of 127.14 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-propylidene-1,3-oxazolidin-2-one is sourced from PubChem (CID 177409820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).