About CID 177410214
CID 177410214 (PubChem CID 177410214) has the molecular formula C3H5N2O2
and a molecular weight of 101.08 g/mol.
Molecular Properties
| Compound Name | CID 177410214 |
| PubChem CID | 177410214 |
| Molecular Formula | C3H5N2O2 |
| Molecular Weight | 101.08 g/mol |
| Exact Mass | 101.04 |
| IUPAC Name | — |
| SMILES | O=[N+]([O-])N1C[CH]C1 |
| InChI | InChI=1S/C3H5N2O2/c6-5(7)4-2-1-3-4/h1H,2-3H2 |
| InChIKey | LYGMZUWFTCDLHQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.08 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 177410214 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177410214?
The IUPAC name of CID 177410214 (CID 177410214) is not available.
What is the SMILES notation for CID 177410214?
The canonical SMILES for CID 177410214 is O=[N+]([O-])N1C[CH]C1.
What is the InChIKey of CID 177410214?
The InChIKey is LYGMZUWFTCDLHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N2O2/c6-5(7)4-2-1-3-4/h1H,2-3H2.
What are the key properties of CID 177410214?
CID 177410214 has a molecular weight of 101.08 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177410214 is sourced from PubChem (CID 177410214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).