C23H27N3O2 — CID 177410317
(12R)-7-phenyl-1,6,10-triazatricyclo[10.7.1.013,18]icosa-13,15,17-triene-9,19-dione (PubChem CID 177410317) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is (12R)-7-phenyl-1,6,10-triazatricyclo[10.7.1.013,18]icosa-13,15,17-triene-9,19-dione.
| Compound Name | (12R)-7-phenyl-1,6,10-triazatricyclo[10.7.1.013,18]icosa-13,15,17-triene-9,19-dione |
|---|---|
| PubChem CID | 177410317 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | (12R)-7-phenyl-1,6,10-triazatricyclo[10.7.1.013,18]icosa-13,15,17-triene-9,19-dione |
| SMILES | O=C1CC(c2ccccc2)NCCCCN2C[C@@H](CN1)c1ccccc1C2=O |
| InChI | InChI=1S/C23H27N3O2/c27-22-14-21(17-8-2-1-3-9-17)24-12-6-7-13-26-16-18(15-25-22)19-10-4-5-11-20(19)23(26)28/h1-5,8-11,18,21,24H,6-7,12-16H2,(H,25,27)/t18-,21?/m1/s1 |
| InChIKey | XRGRYPQJVHKGHR-ITUIMRKVSA-N |
| XLogP | 2.86 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |