About (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one
(5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one (PubChem CID 177410379) has the molecular formula C12H11N3O3
and a molecular weight of 245.24 g/mol. Its IUPAC name is (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one.
Molecular Properties
| Compound Name | (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one |
| PubChem CID | 177410379 |
| Molecular Formula | C12H11N3O3 |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one |
| SMILES | CC1=N/C(=C/c2ccc([N+](=O)[O-])cc2)C(=O)N1C |
| InChI | InChI=1S/C12H11N3O3/c1-8-13-11(12(16)14(8)2)7-9-3-5-10(6-4-9)15(17)18/h3-7H,1-2H3/b11-7+ |
| InChIKey | PAUGHQZICYNISW-YRNVUSSQSA-N |
| XLogP | 1.83 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one?
The IUPAC name of (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one (CID 177410379) is (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one.
What is the SMILES notation for (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one?
The canonical SMILES for (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one is CC1=N/C(=C/c2ccc([N+](=O)[O-])cc2)C(=O)N1C.
What is the InChIKey of (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one?
The InChIKey is PAUGHQZICYNISW-YRNVUSSQSA-N. The full InChI is InChI=1S/C12H11N3O3/c1-8-13-11(12(16)14(8)2)7-9-3-5-10(6-4-9)15(17)18/h3-7H,1-2H3/b11-7+.
What are the key properties of (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one?
(5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one has a molecular weight of 245.24 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-2,3-dimethyl-5-[(4-nitrophenyl)methylidene]imidazol-4-one is sourced from PubChem (CID 177410379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).