C21H38O2Sn — CID 177410390
(1S,2S,4S,5R)-2,4-dimethyl-1-tributylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 177410390) has the molecular formula C21H38O2Sn and a molecular weight of 441.24 g/mol. Its IUPAC name is (1S,2S,4S,5R)-2,4-dimethyl-1-tributylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,2S,4S,5R)-2,4-dimethyl-1-tributylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 177410390 |
| Molecular Formula | C21H38O2Sn |
| Molecular Weight | 441.24 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (1S,2S,4S,5R)-2,4-dimethyl-1-tributylstannyl-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CCCC[Sn](CCCC)(CCCC)[C@]12C=C[C@@H](O1)[C@H](C)C(=O)[C@@H]2C |
| InChI | InChI=1S/C9H11O2.3C4H9.Sn/c1-5-7-3-4-8(11-7)6(2)9(5)10;3*1-3-4-2;/h3-7H,1-2H3;3*1,3-4H2,2H3;/t5-,6+,7+;;;;/m0..../s1 |
| InChIKey | YBNCMZBPSSSDFX-YYWCTZDQSA-N |
| XLogP | 5.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.24 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|