C33H44N2O3 — CID 177410806
(Z)-2-[2,7-ditert-butyl-5-[(E)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-9,9-dimethylxanthen-4-yl]-3-(dimethylamino)prop-2-enal (PubChem CID 177410806) has the molecular formula C33H44N2O3 and a molecular weight of 516.73 g/mol. Its IUPAC name is (Z)-2-[2,7-ditert-butyl-5-[(E)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-9,9-dimethylxanthen-4-yl]-3-(dimethylamino)prop-2-enal.
| Compound Name | (Z)-2-[2,7-ditert-butyl-5-[(E)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-9,9-dimethylxanthen-4-yl]-3-(dimethylamino)prop-2-enal |
|---|---|
| PubChem CID | 177410806 |
| Molecular Formula | C33H44N2O3 |
| Molecular Weight | 516.73 g/mol |
| Exact Mass | 516.34 |
| IUPAC Name | (Z)-2-[2,7-ditert-butyl-5-[(E)-1-(dimethylamino)-3-oxoprop-1-en-2-yl]-9,9-dimethylxanthen-4-yl]-3-(dimethylamino)prop-2-enal |
| SMILES | CN(C)/C=C(\C=O)c1cc(C(C)(C)C)cc2c1Oc1c(/C(C=O)=C\N(C)C)cc(C(C)(C)C)cc1C2(C)C |
| InChI | InChI=1S/C33H44N2O3/c1-31(2,3)23-13-25(21(19-36)17-34(9)10)29-27(15-23)33(7,8)28-16-24(32(4,5)6)14-26(30(28)38-29)22(20-37)18-35(11)12/h13-20H,1-12H3/b21-17-,22-18+ |
| InChIKey | HPGWTKDXDZGTBI-QGFZOGOGSA-N |
| XLogP | 6.92 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.73 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|