C25H34O6 — CID 177412462
(1S,2R,3R,7S,9R,10R,13S,15S)-7-hydroxy-2,4',6,10-tetramethyl-15-(2-methylprop-1-enyl)spiro[14,16-dioxatetracyclo[8.4.2.01,9.03,7]hexadecane-13,5'-furan]-2',8-dione (PubChem CID 177412462) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is (1S,2R,3R,7S,9R,10R,13S,15S)-7-hydroxy-2,4',6,10-tetramethyl-15-(2-methylprop-1-enyl)spiro[14,16-dioxatetracyclo[8.4.2.01,9.03,7]hexadecane-13,5'-furan]-2',8-dione.
| Compound Name | (1S,2R,3R,7S,9R,10R,13S,15S)-7-hydroxy-2,4',6,10-tetramethyl-15-(2-methylprop-1-enyl)spiro[14,16-dioxatetracyclo[8.4.2.01,9.03,7]hexadecane-13,5'-furan]-2',8-dione |
|---|---|
| PubChem CID | 177412462 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (1S,2R,3R,7S,9R,10R,13S,15S)-7-hydroxy-2,4',6,10-tetramethyl-15-(2-methylprop-1-enyl)spiro[14,16-dioxatetracyclo[8.4.2.01,9.03,7]hexadecane-13,5'-furan]-2',8-dione |
| SMILES | CC(C)=C[C@@H]1O[C@]2(C)CC[C@@]3(OC(=O)C=C3C)O[C@]13[C@H](C)[C@H]1CCC(C)[C@@]1(O)C(=O)[C@@H]32 |
| InChI | InChI=1S/C25H34O6/c1-13(2)11-18-25-16(5)17-8-7-14(3)24(17,28)21(27)20(25)22(6,29-18)9-10-23(31-25)15(4)12-19(26)30-23/h11-12,14,16-18,20,28H,7-10H2,1-6H3/t14?,16-,17-,18+,20-,22-,23-,24+,25-/m1/s1 |
| InChIKey | HKFGMTLUOBHJIK-BSUXJTBDSA-N |
| XLogP | 3.47 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|