C46H55Sb — CID 177413562
benzhydrylidene-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane (PubChem CID 177413562) has the molecular formula C46H55Sb and a molecular weight of 729.71 g/mol. Its IUPAC name is benzhydrylidene-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane.
| Compound Name | benzhydrylidene-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane |
|---|---|
| PubChem CID | 177413562 |
| Molecular Formula | C46H55Sb |
| Molecular Weight | 729.71 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | benzhydrylidene-[2,5-bis(3,5-ditert-butylphenyl)cyclopenta-2,4-dien-1-yl]stibane |
| SMILES | CC(C)(C)c1cc(C2=CC=C(c3cc(C(C)(C)C)cc(C(C)(C)C)c3)C2[Sb]=C(c2ccccc2)c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H45.C13H10.Sb/c1-30(2,3)26-16-24(17-27(20-26)31(4,5)6)22-13-14-23(15-22)25-18-28(32(7,8)9)21-29(19-25)33(10,11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h13-21H,1-12H3;1-10H; |
| InChIKey | AFJBKVPICROWBK-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.71 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|