C16H19N4O9P — CID 177413887
[4-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-9-yl)-1,2,3-trihydroxybutyl] dihydrogen phosphate (PubChem CID 177413887) has the molecular formula C16H19N4O9P and a molecular weight of 442.32 g/mol. Its IUPAC name is [4-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-9-yl)-1,2,3-trihydroxybutyl] dihydrogen phosphate.
| Compound Name | [4-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-9-yl)-1,2,3-trihydroxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177413887 |
| Molecular Formula | C16H19N4O9P |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | [4-(7,8-dimethyl-2,4-dioxo-1H-benzo[g]pteridin-9-yl)-1,2,3-trihydroxybutyl] dihydrogen phosphate |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)[nH]c3nc2c(CC(O)C(O)C(O)OP(=O)(O)O)c1C |
| InChI | InChI=1S/C16H19N4O9P/c1-5-3-8-10(18-13-11(17-8)14(23)20-16(25)19-13)7(6(5)2)4-9(21)12(22)15(24)29-30(26,27)28/h3,9,12,15,21-22,24H,4H2,1-2H3,(H2,26,27,28)(H2,18,19,20,23,25) |
| InChIKey | WMFORHVARTVARM-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 218.95 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|