About 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide
4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide (PubChem CID 177414188) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide.
Molecular Properties
| Compound Name | 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide |
| PubChem CID | 177414188 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide |
| SMILES | C=CCN(CC=C)C(=S)CC=C(C)C |
| InChI | InChI=1S/C12H19NS/c1-5-9-13(10-6-2)12(14)8-7-11(3)4/h5-7H,1-2,8-10H2,3-4H3 |
| InChIKey | NHKHGJNCQYFJQC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide?
The IUPAC name of 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide (CID 177414188) is 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide.
What is the SMILES notation for 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide?
The canonical SMILES for 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide is C=CCN(CC=C)C(=S)CC=C(C)C.
What is the InChIKey of 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide?
The InChIKey is NHKHGJNCQYFJQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS/c1-5-9-13(10-6-2)12(14)8-7-11(3)4/h5-7H,1-2,8-10H2,3-4H3.
What are the key properties of 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide?
4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide has a molecular weight of 209.36 g/mol, XLogP of 3.34, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N,N-bis(prop-2-enyl)pent-3-enethioamide is sourced from PubChem (CID 177414188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).