About 1,3-benzothiazole-4,7-dicarboxylic acid
1,3-benzothiazole-4,7-dicarboxylic acid (PubChem CID 177414236) has the molecular formula C9H5NO4S
and a molecular weight of 223.21 g/mol. Its IUPAC name is 1,3-benzothiazole-4,7-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,3-benzothiazole-4,7-dicarboxylic acid |
| PubChem CID | 177414236 |
| Molecular Formula | C9H5NO4S |
| Molecular Weight | 223.21 g/mol |
| Exact Mass | 222.99 |
| IUPAC Name | 1,3-benzothiazole-4,7-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c2scnc12 |
| InChI | InChI=1S/C9H5NO4S/c11-8(12)4-1-2-5(9(13)14)7-6(4)10-3-15-7/h1-3H,(H,11,12)(H,13,14) |
| InChIKey | PRRCGCXELDGHFI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzothiazole-4,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazole-4,7-dicarboxylic acid?
The IUPAC name of 1,3-benzothiazole-4,7-dicarboxylic acid (CID 177414236) is 1,3-benzothiazole-4,7-dicarboxylic acid.
What is the SMILES notation for 1,3-benzothiazole-4,7-dicarboxylic acid?
The canonical SMILES for 1,3-benzothiazole-4,7-dicarboxylic acid is O=C(O)c1ccc(C(=O)O)c2scnc12.
What is the InChIKey of 1,3-benzothiazole-4,7-dicarboxylic acid?
The InChIKey is PRRCGCXELDGHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5NO4S/c11-8(12)4-1-2-5(9(13)14)7-6(4)10-3-15-7/h1-3H,(H,11,12)(H,13,14).
What are the key properties of 1,3-benzothiazole-4,7-dicarboxylic acid?
1,3-benzothiazole-4,7-dicarboxylic acid has a molecular weight of 223.21 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazole-4,7-dicarboxylic acid is sourced from PubChem (CID 177414236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).