C9H12O3 — CID 177414265
(1R,2R,5R,6S,7S,8S)-6,7-dihydroxy-8-methyltricyclo[3.3.0.02,8]octan-3-one (PubChem CID 177414265) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (1R,2R,5R,6S,7S,8S)-6,7-dihydroxy-8-methyltricyclo[3.3.0.02,8]octan-3-one.
| Compound Name | (1R,2R,5R,6S,7S,8S)-6,7-dihydroxy-8-methyltricyclo[3.3.0.02,8]octan-3-one |
|---|---|
| PubChem CID | 177414265 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (1R,2R,5R,6S,7S,8S)-6,7-dihydroxy-8-methyltricyclo[3.3.0.02,8]octan-3-one |
| SMILES | C[C@]12[C@@H]3[C@@H](CC(=O)[C@H]31)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C9H12O3/c1-9-5-3(7(11)8(9)12)2-4(10)6(5)9/h3,5-8,11-12H,2H2,1H3/t3-,5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | BXANOYKSVSISBD-JIGKCKMHSA-N |
| XLogP | -0.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |