About 2'-methylspiro[1,3-dihydroindene-2,5'-thiane]
2'-methylspiro[1,3-dihydroindene-2,5'-thiane] (PubChem CID 177414356) has the molecular formula C14H18S
and a molecular weight of 218.37 g/mol. Its IUPAC name is 2'-methylspiro[1,3-dihydroindene-2,5'-thiane].
Molecular Properties
| Compound Name | 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] |
| PubChem CID | 177414356 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] |
| SMILES | CC1CCC2(CS1)Cc1ccccc1C2 |
| InChI | InChI=1S/C14H18S/c1-11-6-7-14(10-15-11)8-12-4-2-3-5-13(12)9-14/h2-5,11H,6-10H2,1H3 |
| InChIKey | MFJSUDBNVJBGAY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-methylspiro[1,3-dihydroindene-2,5'-thiane]?
The IUPAC name of 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] (CID 177414356) is 2'-methylspiro[1,3-dihydroindene-2,5'-thiane].
What is the SMILES notation for 2'-methylspiro[1,3-dihydroindene-2,5'-thiane]?
The canonical SMILES for 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] is CC1CCC2(CS1)Cc1ccccc1C2.
What is the InChIKey of 2'-methylspiro[1,3-dihydroindene-2,5'-thiane]?
The InChIKey is MFJSUDBNVJBGAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18S/c1-11-6-7-14(10-15-11)8-12-4-2-3-5-13(12)9-14/h2-5,11H,6-10H2,1H3.
What are the key properties of 2'-methylspiro[1,3-dihydroindene-2,5'-thiane]?
2'-methylspiro[1,3-dihydroindene-2,5'-thiane] has a molecular weight of 218.37 g/mol, XLogP of 3.69, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-methylspiro[1,3-dihydroindene-2,5'-thiane] is sourced from PubChem (CID 177414356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).