C9H8Cl5NS — CID 177414419
4-methyl-N-(1,1,2,2,2-pentachloroethylsulfanyl)aniline (PubChem CID 177414419) has the molecular formula C9H8Cl5NS and a molecular weight of 339.50 g/mol. Its IUPAC name is 4-methyl-N-(1,1,2,2,2-pentachloroethylsulfanyl)aniline.
| Compound Name | 4-methyl-N-(1,1,2,2,2-pentachloroethylsulfanyl)aniline |
|---|---|
| PubChem CID | 177414419 |
| Molecular Formula | C9H8Cl5NS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 336.88 |
| IUPAC Name | 4-methyl-N-(1,1,2,2,2-pentachloroethylsulfanyl)aniline |
| SMILES | Cc1ccc(NSC(Cl)(Cl)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C9H8Cl5NS/c1-6-2-4-7(5-3-6)15-16-9(13,14)8(10,11)12/h2-5,15H,1H3 |
| InChIKey | CXXMZLCFAPZVRR-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|