C22H37BrO2Si — CID 177414675
2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]cyclopent-2-en-1-ol (PubChem CID 177414675) has the molecular formula C22H37BrO2Si and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]cyclopent-2-en-1-ol.
| Compound Name | 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 177414675 |
| Molecular Formula | C22H37BrO2Si |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-bromo-4-[tert-butyl(dimethyl)silyl]oxy-1-[(E)-2-(2,6,6-trimethylcyclohex-2-en-1-yl)ethenyl]cyclopent-2-en-1-ol |
| SMILES | CC1=CCCC(C)(C)C1/C=C/C1(O)CC(O[Si](C)(C)C(C)(C)C)C=C1Br |
| InChI | InChI=1S/C22H37BrO2Si/c1-16-10-9-12-21(5,6)18(16)11-13-22(24)15-17(14-19(22)23)25-26(7,8)20(2,3)4/h10-11,13-14,17-18,24H,9,12,15H2,1-8H3/b13-11+ |
| InChIKey | GTPGOGJRONLKKX-ACCUITESSA-N |
| XLogP | 6.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|