About 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene
2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene (PubChem CID 177414686) has the molecular formula C24H40N2O
and a molecular weight of 372.60 g/mol. Its IUPAC name is 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene.
Molecular Properties
| Compound Name | 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene |
| PubChem CID | 177414686 |
| Molecular Formula | C24H40N2O |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.31 |
| IUPAC Name | 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene |
| SMILES | [O-][n+]1c2c3nc(c1CCCCCCCCCC3)CCCCCCCCCC2 |
| InChI | InChI=1S/C24H40N2O/c27-26-23-19-15-11-7-3-1-5-9-13-17-21-24(26)20-16-12-8-4-2-6-10-14-18-22(23)25-21/h1-20H2 |
| InChIKey | LMEYRXVNNCJHHF-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene?
The IUPAC name of 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene (CID 177414686) is 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene.
What is the SMILES notation for 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene?
The canonical SMILES for 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene is [O-][n+]1c2c3nc(c1CCCCCCCCCC3)CCCCCCCCCC2.
What is the InChIKey of 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene?
The InChIKey is LMEYRXVNNCJHHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H40N2O/c27-26-23-19-15-11-7-3-1-5-9-13-17-21-24(26)20-16-12-8-4-2-6-10-14-18-22(23)25-21/h1-20H2.
What are the key properties of 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene?
2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene has a molecular weight of 372.60 g/mol, XLogP of 6.15, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxido-15-aza-2-azoniatricyclo[12.12.0.03,16]hexacosa-1,3(16),14-triene is sourced from PubChem (CID 177414686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).