About (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 177414980) has the molecular formula C6H5FO3
and a molecular weight of 144.10 g/mol. Its IUPAC name is (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 177414980 |
| Molecular Formula | C6H5FO3 |
| Molecular Weight | 144.10 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | O=C1C(F)=C[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C6H5FO3/c7-4-1-3-2-9-6(10-3)5(4)8/h1,3,6H,2H2/t3-,6+/m0/s1 |
| InChIKey | AULOPSOAILWXGL-BBIVZNJYSA-N |
| XLogP | 0.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.10 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 177414980) is (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is O=C1C(F)=C[C@H]2CO[C@@H]1O2.
What is the InChIKey of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is AULOPSOAILWXGL-BBIVZNJYSA-N. The full InChI is InChI=1S/C6H5FO3/c7-4-1-3-2-9-6(10-3)5(4)8/h1,3,6H,2H2/t3-,6+/m0/s1.
What are the key properties of (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 144.10 g/mol, XLogP of 0.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-3-fluoro-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 177414980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).