C38H45ClN2O8S2 — CID 177415156
(2-chlorophenyl)methyl 4-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl-methylamino]piperidine-1-carbodithioate (PubChem CID 177415156) has the molecular formula C38H45ClN2O8S2 and a molecular weight of 757.37 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 4-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl-methylamino]piperidine-1-carbodithioate.
| Compound Name | (2-chlorophenyl)methyl 4-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl-methylamino]piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 177415156 |
| Molecular Formula | C38H45ClN2O8S2 |
| Molecular Weight | 757.37 g/mol |
| Exact Mass | 756.23 |
| IUPAC Name | (2-chlorophenyl)methyl 4-[4-[5,7-dimethoxy-4-oxo-2-(3,4,5-trimethoxyphenyl)chromen-3-yl]oxybutyl-methylamino]piperidine-1-carbodithioate |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCN(C)C3CCN(C(=S)SCc4ccccc4Cl)CC3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C38H45ClN2O8S2/c1-40(26-13-16-41(17-14-26)38(50)51-23-24-11-7-8-12-28(24)39)15-9-10-18-48-37-34(42)33-29(44-3)21-27(43-2)22-30(33)49-35(37)25-19-31(45-4)36(47-6)32(20-25)46-5/h7-8,11-12,19-22,26H,9-10,13-18,23H2,1-6H3 |
| InChIKey | HCTNSUCTWOAIBP-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.37 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|