About 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol
1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol (PubChem CID 177415207) has the molecular formula C7H8F10N6OS2
and a molecular weight of 446.30 g/mol. Its IUPAC name is 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol.
Molecular Properties
| Compound Name | 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol |
| PubChem CID | 177415207 |
| Molecular Formula | C7H8F10N6OS2 |
| Molecular Weight | 446.30 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol |
| SMILES | OC(Cn1cc(S(F)(F)(F)(F)F)nn1)Cn1cc(S(F)(F)(F)(F)F)nn1 |
| InChI | InChI=1S/C7H8F10N6OS2/c8-25(9,10,11,12)6-3-22(20-18-6)1-5(24)2-23-4-7(19-21-23)26(13,14,15,16)17/h3-5,24H,1-2H2 |
| InChIKey | ZIPFZZROJFDMDV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol?
The IUPAC name of 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol (CID 177415207) is 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol.
What is the SMILES notation for 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol?
The canonical SMILES for 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol is OC(Cn1cc(S(F)(F)(F)(F)F)nn1)Cn1cc(S(F)(F)(F)(F)F)nn1.
What is the InChIKey of 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol?
The InChIKey is ZIPFZZROJFDMDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F10N6OS2/c8-25(9,10,11,12)6-3-22(20-18-6)1-5(24)2-23-4-7(19-21-23)26(13,14,15,16)17/h3-5,24H,1-2H2.
What are the key properties of 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol?
1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol has a molecular weight of 446.30 g/mol, XLogP of 4.25, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis[4-(pentafluoro-λ6-sulfanyl)triazol-1-yl]propan-2-ol is sourced from PubChem (CID 177415207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).