C7H4S7 — CID 177415678
2-(1,3-dithiolan-2-ylidene)-[1,3]dithiolo[4,5-d][1,3]dithiole-5-thione (PubChem CID 177415678) has the molecular formula C7H4S7 and a molecular weight of 312.58 g/mol. Its IUPAC name is 2-(1,3-dithiolan-2-ylidene)-[1,3]dithiolo[4,5-d][1,3]dithiole-5-thione.
| Compound Name | 2-(1,3-dithiolan-2-ylidene)-[1,3]dithiolo[4,5-d][1,3]dithiole-5-thione |
|---|---|
| PubChem CID | 177415678 |
| Molecular Formula | C7H4S7 |
| Molecular Weight | 312.58 g/mol |
| Exact Mass | 311.84 |
| IUPAC Name | 2-(1,3-dithiolan-2-ylidene)-[1,3]dithiolo[4,5-d][1,3]dithiole-5-thione |
| SMILES | S=c1sc2c(s1)SC(=C1SCCS1)S2 |
| InChI | InChI=1S/C7H4S7/c8-7-13-5-6(14-7)12-4(11-5)3-9-1-2-10-3/h1-2H2 |
| InChIKey | WFZCIEHEYWTVRQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|