C15H24O3Si — CID 177416672
(1R,6R,12S)-9-methyl-7-trimethylsilyl-10,13-dioxatetracyclo[7.3.1.01,6.07,12]tridecan-11-one (PubChem CID 177416672) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is (1R,6R,12S)-9-methyl-7-trimethylsilyl-10,13-dioxatetracyclo[7.3.1.01,6.07,12]tridecan-11-one.
| Compound Name | (1R,6R,12S)-9-methyl-7-trimethylsilyl-10,13-dioxatetracyclo[7.3.1.01,6.07,12]tridecan-11-one |
|---|---|
| PubChem CID | 177416672 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1R,6R,12S)-9-methyl-7-trimethylsilyl-10,13-dioxatetracyclo[7.3.1.01,6.07,12]tridecan-11-one |
| SMILES | CC12CC3([Si](C)(C)C)C(C(=O)O1)[C@]1(CCCC[C@@H]31)O2 |
| InChI | InChI=1S/C15H24O3Si/c1-13-9-15(19(2,3)4)10-7-5-6-8-14(10,18-13)11(15)12(16)17-13/h10-11H,5-9H2,1-4H3/t10-,11?,13?,14-,15?/m1/s1 |
| InChIKey | NRSMGNLIWVSDIR-WQJRTYQASA-N |
| XLogP | 3.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|