C75H115Si7- — CID 177416906
3,4,4,6,6-pentakis[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4,5,6-hexasila-7-silanidapentacyclo[3.2.0.01,3.02,5.02,7]heptane (PubChem CID 177416906) has the molecular formula C75H115Si7- and a molecular weight of 1213.35 g/mol. Its IUPAC name is 3,4,4,6,6-pentakis[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4,5,6-hexasila-7-silanidapentacyclo[3.2.0.01,3.02,5.02,7]heptane.
| Compound Name | 3,4,4,6,6-pentakis[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4,5,6-hexasila-7-silanidapentacyclo[3.2.0.01,3.02,5.02,7]heptane |
|---|---|
| PubChem CID | 177416906 |
| Molecular Formula | C75H115Si7- |
| Molecular Weight | 1213.35 g/mol |
| Exact Mass | 1211.74 |
| IUPAC Name | 3,4,4,6,6-pentakis[2,4,6-tri(propan-2-yl)phenyl]-1,2,3,4,5,6-hexasila-7-silanidapentacyclo[3.2.0.01,3.02,5.02,7]heptane |
| SMILES | CC(C)c1cc(C(C)C)c([Si]2(c3c(C(C)C)cc(C(C)C)cc3C(C)C)[Si-]3[Si]45[Si]6(c7c(C(C)C)cc(C(C)C)cc7C(C)C)[Si](c7c(C(C)C)cc(C(C)C)cc7C(C)C)(c7c(C(C)C)cc(C(C)C)cc7C(C)C)[Si]24[Si]365)c(C(C)C)c1 |
| InChI | InChI=1S/C75H115Si7/c1-41(2)56-31-61(46(11)12)71(62(32-56)47(13)14)77(72-63(48(15)16)33-57(42(3)4)34-64(72)49(17)18)76-80-79(75-69(54(27)28)39-60(45(9)10)40-70(75)55(29)30)78(82(77,80)81(76,79)80,73-65(50(19)20)35-58(43(5)6)36-66(73)51(21)22)74-67(52(23)24)37-59(44(7)8)38-68(74)53(25)26/h31-55H,1-30H3/q-1 |
| InChIKey | CXFKTXFCSWGCND-UHFFFAOYSA-N |
| XLogP | 18.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1213.35 |
| LogP ≤ 5 | 18.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|