C10H11N5 — CID 177417633
N-[(E)-(2-methyl-1H-imidazol-5-yl)methylideneamino]pyridin-2-amine (PubChem CID 177417633) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is N-[(E)-(2-methyl-1H-imidazol-5-yl)methylideneamino]pyridin-2-amine.
| Compound Name | N-[(E)-(2-methyl-1H-imidazol-5-yl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 177417633 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[(E)-(2-methyl-1H-imidazol-5-yl)methylideneamino]pyridin-2-amine |
| SMILES | Cc1ncc(/C=N/Nc2ccccn2)[nH]1 |
| InChI | InChI=1S/C10H11N5/c1-8-12-6-9(14-8)7-13-15-10-4-2-3-5-11-10/h2-7H,1H3,(H,11,15)(H,12,14)/b13-7+ |
| InChIKey | JECCIYMWTZFRDD-NTUHNPAUSA-N |
| XLogP | 1.56 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|