C24H28N4O2 — CID 177418004
bis[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]diazene (PubChem CID 177418004) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is bis[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]diazene.
| Compound Name | bis[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]diazene |
|---|---|
| PubChem CID | 177418004 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | bis[2-[(4S)-4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl]phenyl]diazene |
| SMILES | CC(C)[C@H]1COC(c2ccccc2/N=N/c2ccccc2C2=N[C@@H](C(C)C)CO2)=N1 |
| InChI | InChI=1S/C24H28N4O2/c1-15(2)21-13-29-23(25-21)17-9-5-7-11-19(17)27-28-20-12-8-6-10-18(20)24-26-22(14-30-24)16(3)4/h5-12,15-16,21-22H,13-14H2,1-4H3/b28-27+/t21-,22-/m1/s1 |
| InChIKey | TZHKIKIGCMTDAA-QRZAGKNRSA-N |
| XLogP | 5.70 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|