C32H50O8Si — CID 177418532
[(2R)-pent-4-en-2-yl] 2-[(3Z,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoocta-3,7-dienyl]-4,6-bis(ethoxymethoxy)benzoate (PubChem CID 177418532) has the molecular formula C32H50O8Si and a molecular weight of 590.83 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] 2-[(3Z,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoocta-3,7-dienyl]-4,6-bis(ethoxymethoxy)benzoate.
| Compound Name | [(2R)-pent-4-en-2-yl] 2-[(3Z,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoocta-3,7-dienyl]-4,6-bis(ethoxymethoxy)benzoate |
|---|---|
| PubChem CID | 177418532 |
| Molecular Formula | C32H50O8Si |
| Molecular Weight | 590.83 g/mol |
| Exact Mass | 590.33 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] 2-[(3Z,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-oxoocta-3,7-dienyl]-4,6-bis(ethoxymethoxy)benzoate |
| SMILES | C=CC[C@@H](C)OC(=O)c1c(CC(=O)/C=C\C[C@@H](C=C)O[Si](C)(C)C(C)(C)C)cc(OCOCC)cc1OCOCC |
| InChI | InChI=1S/C32H50O8Si/c1-11-16-24(5)39-31(34)30-25(20-28(37-22-35-13-3)21-29(30)38-23-36-14-4)19-26(33)17-15-18-27(12-2)40-41(9,10)32(6,7)8/h11-12,15,17,20-21,24,27H,1-2,13-14,16,18-19,22-23H2,3-10H3/b17-15-/t24-,27-/m1/s1 |
| InChIKey | YSUUFXCSFCVJCR-NDEGZFIQSA-N |
| XLogP | 7.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.83 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|