C22H30O7 — CID 177418940
[(6E,10Z)-9-acetyloxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-methylbutanoate (PubChem CID 177418940) has the molecular formula C22H30O7 and a molecular weight of 406.48 g/mol. Its IUPAC name is [(6E,10Z)-9-acetyloxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-methylbutanoate.
| Compound Name | [(6E,10Z)-9-acetyloxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 177418940 |
| Molecular Formula | C22H30O7 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [(6E,10Z)-9-acetyloxy-6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-methylbutanoate |
| SMILES | C=C1C(=O)OC2/C=C(/C)C(OC(C)=O)C/C=C(/CO)CC(OC(=O)C(C)CC)C12 |
| InChI | InChI=1S/C22H30O7/c1-6-12(2)21(25)28-19-10-16(11-23)7-8-17(27-15(5)24)13(3)9-18-20(19)14(4)22(26)29-18/h7,9,12,17-20,23H,4,6,8,10-11H2,1-3,5H3/b13-9-,16-7+ |
| InChIKey | RIXONVTVUDLKIW-QLHDBZGNSA-N |
| XLogP | 2.63 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|