C52H76N4 — CID 177419141
12,13,30,31-tetraethyl-39,40,43,46-tetrazatridecacyclo[32.2.2.26,9.216,19.224,27.13,32.14,11.114,21.122,29.02,33.05,10.015,20.023,28]octatetraconta-7,17,25,35-tetraene (PubChem CID 177419141) has the molecular formula C52H76N4 and a molecular weight of 757.21 g/mol. Its IUPAC name is 12,13,30,31-tetraethyl-39,40,43,46-tetrazatridecacyclo[32.2.2.26,9.216,19.224,27.13,32.14,11.114,21.122,29.02,33.05,10.015,20.023,28]octatetraconta-7,17,25,35-tetraene.
| Compound Name | 12,13,30,31-tetraethyl-39,40,43,46-tetrazatridecacyclo[32.2.2.26,9.216,19.224,27.13,32.14,11.114,21.122,29.02,33.05,10.015,20.023,28]octatetraconta-7,17,25,35-tetraene |
|---|---|
| PubChem CID | 177419141 |
| Molecular Formula | C52H76N4 |
| Molecular Weight | 757.21 g/mol |
| Exact Mass | 756.61 |
| IUPAC Name | 12,13,30,31-tetraethyl-39,40,43,46-tetrazatridecacyclo[32.2.2.26,9.216,19.224,27.13,32.14,11.114,21.122,29.02,33.05,10.015,20.023,28]octatetraconta-7,17,25,35-tetraene |
| SMILES | CCC1C(CC)C2NC(C3NC(C(CC)C(CC)C4NC(C5NC1C1C6C=CC(CC6)C51)C1C5C=CC(CC5)C41)C1C4C=CC(CC4)C31)C1C3C=CC(CC3)C21 |
| InChI | InChI=1S/C52H76N4/c1-5-33-34(6-2)46-38-26-11-19-30(20-12-26)42(38)51(54-46)52-44-32-23-15-28(16-24-32)40(44)48(56-52)36(8-4)35(7-3)47-39-27-13-21-31(22-14-27)43(39)50(55-47)49-41-29-17-9-25(10-18-29)37(41)45(33)53-49/h9,11,13,15,17,19,21,23,25-56H,5-8,10,12,14,16,18,20,22,24H2,1-4H3 |
| InChIKey | FAESJNAPXFAKFF-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.21 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|