About copper;benzene;butane
copper;benzene;butane (PubChem CID 177419309) has the molecular formula C10H14Cu
and a molecular weight of 197.77 g/mol. Its IUPAC name is copper;benzene;butane.
Molecular Properties
| Compound Name | copper;benzene;butane |
| PubChem CID | 177419309 |
| Molecular Formula | C10H14Cu |
| Molecular Weight | 197.77 g/mol |
| Exact Mass | 197.04 |
| IUPAC Name | copper;benzene;butane |
| SMILES | [CH2-]CCC.[Cu+2].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.C4H9.Cu/c1-2-4-6-5-3-1;1-3-4-2;/h1-5H;1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | KTAOIVOXVUYJIQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.77 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper;benzene;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;benzene;butane?
The IUPAC name of copper;benzene;butane (CID 177419309) is copper;benzene;butane.
What is the SMILES notation for copper;benzene;butane?
The canonical SMILES for copper;benzene;butane is [CH2-]CCC.[Cu+2].[c-]1ccccc1.
What is the InChIKey of copper;benzene;butane?
The InChIKey is KTAOIVOXVUYJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C4H9.Cu/c1-2-4-6-5-3-1;1-3-4-2;/h1-5H;1,3-4H2,2H3;/q2*-1;+2.
What are the key properties of copper;benzene;butane?
copper;benzene;butane has a molecular weight of 197.77 g/mol, XLogP of 3.10, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper;benzene;butane is sourced from PubChem (CID 177419309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).