C21H19N5OS2 — CID 177419417
3-(furan-2-yl)-5-[4-(phenylcarbamothioylamino)phenyl]-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 177419417) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-[4-(phenylcarbamothioylamino)phenyl]-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 3-(furan-2-yl)-5-[4-(phenylcarbamothioylamino)phenyl]-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 177419417 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | 3-(furan-2-yl)-5-[4-(phenylcarbamothioylamino)phenyl]-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C(c2ccc(NC(=S)Nc3ccccc3)cc2)CC1c1ccco1 |
| InChI | InChI=1S/C21H19N5OS2/c22-20(28)26-18(19-7-4-12-27-19)13-17(25-26)14-8-10-16(11-9-14)24-21(29)23-15-5-2-1-3-6-15/h1-12,18H,13H2,(H2,22,28)(H2,23,24,29) |
| InChIKey | VEOXSAFOGFNTGY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|