C26H24N2 — CID 177419509
3-[2-[2-[2-[3-(dimethylamino)phenyl]ethynyl]phenyl]ethynyl]-N,N-dimethylaniline (PubChem CID 177419509) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[2-[2-[2-[3-(dimethylamino)phenyl]ethynyl]phenyl]ethynyl]-N,N-dimethylaniline.
| Compound Name | 3-[2-[2-[2-[3-(dimethylamino)phenyl]ethynyl]phenyl]ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 177419509 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[2-[2-[2-[3-(dimethylamino)phenyl]ethynyl]phenyl]ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C#Cc2ccccc2C#Cc2cccc(N(C)C)c2)c1 |
| InChI | InChI=1S/C26H24N2/c1-27(2)25-13-7-9-21(19-25)15-17-23-11-5-6-12-24(23)18-16-22-10-8-14-26(20-22)28(3)4/h5-14,19-20H,1-4H3 |
| InChIKey | JOAMXXXHMDMNAK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|