C27H32O — CID 177419680
(2E,6E,11R)-4,4,7,11-tetramethyl-10-(4-phenylphenyl)cycloundeca-2,6-dien-1-one (PubChem CID 177419680) has the molecular formula C27H32O and a molecular weight of 372.55 g/mol. Its IUPAC name is (2E,6E,11R)-4,4,7,11-tetramethyl-10-(4-phenylphenyl)cycloundeca-2,6-dien-1-one.
| Compound Name | (2E,6E,11R)-4,4,7,11-tetramethyl-10-(4-phenylphenyl)cycloundeca-2,6-dien-1-one |
|---|---|
| PubChem CID | 177419680 |
| Molecular Formula | C27H32O |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | (2E,6E,11R)-4,4,7,11-tetramethyl-10-(4-phenylphenyl)cycloundeca-2,6-dien-1-one |
| SMILES | C/C1=C\CC(C)(C)/C=C/C(=O)[C@H](C)C(c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C27H32O/c1-20-10-15-25(21(2)26(28)17-19-27(3,4)18-16-20)24-13-11-23(12-14-24)22-8-6-5-7-9-22/h5-9,11-14,16-17,19,21,25H,10,15,18H2,1-4H3/b19-17+,20-16+/t21-,25?/m1/s1 |
| InChIKey | IJRUVORDKZJSNT-VRASBKFTSA-N |
| XLogP | 7.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|