C20H30O5 — CID 177420186
(1R,2E,6E,14S)-10-hydroperoxy-5,8-dihydroxy-3,7,15,15-tetramethyl-11-methylidenebicyclo[12.1.0]pentadeca-2,6-dien-4-one (PubChem CID 177420186) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1R,2E,6E,14S)-10-hydroperoxy-5,8-dihydroxy-3,7,15,15-tetramethyl-11-methylidenebicyclo[12.1.0]pentadeca-2,6-dien-4-one.
| Compound Name | (1R,2E,6E,14S)-10-hydroperoxy-5,8-dihydroxy-3,7,15,15-tetramethyl-11-methylidenebicyclo[12.1.0]pentadeca-2,6-dien-4-one |
|---|---|
| PubChem CID | 177420186 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1R,2E,6E,14S)-10-hydroperoxy-5,8-dihydroxy-3,7,15,15-tetramethyl-11-methylidenebicyclo[12.1.0]pentadeca-2,6-dien-4-one |
| SMILES | C=C1CC[C@H]2[C@@H](/C=C(\C)C(=O)C(O)/C=C(\C)C(O)CC1OO)C2(C)C |
| InChI | InChI=1S/C20H30O5/c1-11-6-7-14-15(20(14,4)5)8-13(3)19(23)17(22)9-12(2)16(21)10-18(11)25-24/h8-9,14-18,21-22,24H,1,6-7,10H2,2-5H3/b12-9+,13-8+/t14-,15+,16?,17?,18?/m0/s1 |
| InChIKey | ANECVVQQNHZERU-PWVLLCEDSA-N |
| XLogP | 3.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|