C17H24O3 — CID 177420243
(3R,3aR,4R,6aS)-3-but-3-enyl-6,6-dimethyl-4-(2-methylprop-2-enoyl)-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one (PubChem CID 177420243) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3R,3aR,4R,6aS)-3-but-3-enyl-6,6-dimethyl-4-(2-methylprop-2-enoyl)-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one.
| Compound Name | (3R,3aR,4R,6aS)-3-but-3-enyl-6,6-dimethyl-4-(2-methylprop-2-enoyl)-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 177420243 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3R,3aR,4R,6aS)-3-but-3-enyl-6,6-dimethyl-4-(2-methylprop-2-enoyl)-3a,4,5,6a-tetrahydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C=CCC[C@H]1C(=O)O[C@H]2[C@@H]1[C@H](C(=O)C(=C)C)CC2(C)C |
| InChI | InChI=1S/C17H24O3/c1-6-7-8-11-13-12(14(18)10(2)3)9-17(4,5)15(13)20-16(11)19/h6,11-13,15H,1-2,7-9H2,3-5H3/t11-,12-,13+,15+/m1/s1 |
| InChIKey | LTFHYZBDUQFSRB-CXTNEJHOSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|